C19H30O5S2 — CID 15474964
3-phenylmethoxy-1,5-dioxa-9,13-dithiacyclohexadecane-7,15-diol (PubChem CID 15474964) has the molecular formula C19H30O5S2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 3-phenylmethoxy-1,5-dioxa-9,13-dithiacyclohexadecane-7,15-diol.
| Compound Name | 3-phenylmethoxy-1,5-dioxa-9,13-dithiacyclohexadecane-7,15-diol |
|---|---|
| PubChem CID | 15474964 |
| Molecular Formula | C19H30O5S2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 3-phenylmethoxy-1,5-dioxa-9,13-dithiacyclohexadecane-7,15-diol |
| SMILES | OC1COCC(OCc2ccccc2)COCC(O)CSCCCSC1 |
| InChI | InChI=1S/C19H30O5S2/c20-17-10-22-12-19(24-9-16-5-2-1-3-6-16)13-23-11-18(21)15-26-8-4-7-25-14-17/h1-3,5-6,17-21H,4,7-15H2 |
| InChIKey | YMXCVWLZWSCAMB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |