C22H23F3N6O — CID 159979154
(7S)-4,5,7,8-tetramethyl-2-[2-[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one (PubChem CID 159979154) has the molecular formula C22H23F3N6O and a molecular weight of 444.46 g/mol. Its IUPAC name is (7S)-4,5,7,8-tetramethyl-2-[2-[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one.
| Compound Name | (7S)-4,5,7,8-tetramethyl-2-[2-[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one |
|---|---|
| PubChem CID | 159979154 |
| Molecular Formula | C22H23F3N6O |
| Molecular Weight | 444.46 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | (7S)-4,5,7,8-tetramethyl-2-[2-[1-[(2,3,4-trifluorophenyl)methyl]pyrazol-4-yl]ethyl]-7H-pteridin-6-one |
| SMILES | Cc1nc(CCc2cnn(Cc3ccc(F)c(F)c3F)c2)nc2c1N(C)C(=O)[C@H](C)N2C |
| InChI | InChI=1S/C22H23F3N6O/c1-12-20-21(29(3)13(2)22(32)30(20)4)28-17(27-12)8-5-14-9-26-31(10-14)11-15-6-7-16(23)19(25)18(15)24/h6-7,9-10,13H,5,8,11H2,1-4H3/t13-/m0/s1 |
| InChIKey | OFNPLLDBNNBJQH-ZDUSSCGKSA-N |
| XLogP | 3.03 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.46 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|