C17H14F3N5O4 — CID 15998096
2-(3-methoxy-5-methyl-4-nitropyrazol-1-yl)-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine (PubChem CID 15998096) has the molecular formula C17H14F3N5O4 and a molecular weight of 409.32 g/mol. Its IUPAC name is 2-(3-methoxy-5-methyl-4-nitropyrazol-1-yl)-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 2-(3-methoxy-5-methyl-4-nitropyrazol-1-yl)-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 15998096 |
| Molecular Formula | C17H14F3N5O4 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-(3-methoxy-5-methyl-4-nitropyrazol-1-yl)-4-(3-methoxyphenyl)-6-(trifluoromethyl)pyrimidine |
| SMILES | COc1cccc(-c2cc(C(F)(F)F)nc(-n3nc(OC)c([N+](=O)[O-])c3C)n2)c1 |
| InChI | InChI=1S/C17H14F3N5O4/c1-9-14(25(26)27)15(29-3)23-24(9)16-21-12(8-13(22-16)17(18,19)20)10-5-4-6-11(7-10)28-2/h4-8H,1-3H3 |
| InChIKey | VGNPNVKMYMACAQ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|