C14H9F3N6O3 — CID 17253473
4-(3-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine (PubChem CID 17253473) has the molecular formula C14H9F3N6O3 and a molecular weight of 366.26 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine.
| Compound Name | 4-(3-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 17253473 |
| Molecular Formula | C14H9F3N6O3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 4-(3-methoxyphenyl)-2-(3-nitro-1,2,4-triazol-1-yl)-6-(trifluoromethyl)pyrimidine |
| SMILES | COc1cccc(-c2cc(C(F)(F)F)nc(-n3cnc([N+](=O)[O-])n3)n2)c1 |
| InChI | InChI=1S/C14H9F3N6O3/c1-26-9-4-2-3-8(5-9)10-6-11(14(15,16)17)20-13(19-10)22-7-18-12(21-22)23(24)25/h2-7H,1H3 |
| InChIKey | WXSBWXGPZWGCHF-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|