C16H19ClN4O2S — CID 159985827
ethyl 4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazine-1-carboxylate;hydrochloride (PubChem CID 159985827) has the molecular formula C16H19ClN4O2S and a molecular weight of 366.87 g/mol. Its IUPAC name is ethyl 4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazine-1-carboxylate;hydrochloride.
| Compound Name | ethyl 4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 159985827 |
| Molecular Formula | C16H19ClN4O2S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | ethyl 4-(3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaen-8-yl)piperazine-1-carboxylate;hydrochloride |
| SMILES | CCOC(=O)N1CCN(c2nc3ccsc3n3cccc23)CC1.Cl |
| InChI | InChI=1S/C16H18N4O2S.ClH/c1-2-22-16(21)19-9-7-18(8-10-19)14-13-4-3-6-20(13)15-12(17-14)5-11-23-15;/h3-6,11H,2,7-10H2,1H3;1H |
| InChIKey | OGIAQNVMBROUER-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |