C20H26N4O — CID 159986833
6-[[5-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N'-ethylpyridine-3-carboximidamide (PubChem CID 159986833) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 6-[[5-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N'-ethylpyridine-3-carboximidamide.
| Compound Name | 6-[[5-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N'-ethylpyridine-3-carboximidamide |
|---|---|
| PubChem CID | 159986833 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 6-[[5-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]-N'-ethylpyridine-3-carboximidamide |
| SMILES | CC/N=C(\N)c1ccc(Oc2ccc3c(c2)CCCC3CCN)nc1 |
| InChI | InChI=1S/C20H26N4O/c1-2-23-20(22)16-6-9-19(24-13-16)25-17-7-8-18-14(10-11-21)4-3-5-15(18)12-17/h6-9,12-14H,2-5,10-11,21H2,1H3,(H2,22,23) |
| InChIKey | OGLFECPXDFUKJU-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|