C25H33N3O2 — CID 66673374
6-[[8-[(2-cyclohexylethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide (PubChem CID 66673374) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is 6-[[8-[(2-cyclohexylethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide.
| Compound Name | 6-[[8-[(2-cyclohexylethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66673374 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | 6-[[8-[(2-cyclohexylethylamino)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(Oc2ccc3c(c2)C(CNCCC2CCCCC2)CCC3)nc1 |
| InChI | InChI=1S/C25H33N3O2/c26-25(29)21-10-12-24(28-17-21)30-22-11-9-19-7-4-8-20(23(19)15-22)16-27-14-13-18-5-2-1-3-6-18/h9-12,15,17-18,20,27H,1-8,13-14,16H2,(H2,26,29) |
| InChIKey | MSIGWDNLJHUPSZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|