C20H24N4O3 — CID 66673417
6-[[5-(2-acetamidoethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide (PubChem CID 66673417) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 6-[[5-(2-acetamidoethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide.
| Compound Name | 6-[[5-(2-acetamidoethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 66673417 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 6-[[5-(2-acetamidoethylamino)-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]pyridine-3-carboxamide |
| SMILES | CC(=O)NCCNC1CCCc2cc(Oc3ccc(C(N)=O)cn3)ccc21 |
| InChI | InChI=1S/C20H24N4O3/c1-13(25)22-9-10-23-18-4-2-3-14-11-16(6-7-17(14)18)27-19-8-5-15(12-24-19)20(21)26/h5-8,11-12,18,23H,2-4,9-10H2,1H3,(H2,21,26)(H,22,25) |
| InChIKey | NMIGFZQMEIHLAB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|