C51H45F3N12O6 — CID 159987979
6-[dideuterio-(1-methylpyrazol-4-yl)methyl]-2-(3-fluoro-5-nitrophenyl)-3-methylpyridine (PubChem CID 159987979) has the molecular formula C51H45F3N12O6 and a molecular weight of 985.03 g/mol. Its IUPAC name is 6-[dideuterio-(1-methylpyrazol-4-yl)methyl]-2-(3-fluoro-5-nitrophenyl)-3-methylpyridine.
| Compound Name | 6-[dideuterio-(1-methylpyrazol-4-yl)methyl]-2-(3-fluoro-5-nitrophenyl)-3-methylpyridine |
|---|---|
| PubChem CID | 159987979 |
| Molecular Formula | C51H45F3N12O6 |
| Molecular Weight | 985.03 g/mol |
| Exact Mass | 984.39 |
| IUPAC Name | 6-[dideuterio-(1-methylpyrazol-4-yl)methyl]-2-(3-fluoro-5-nitrophenyl)-3-methylpyridine |
| SMILES | [2H]C([2H])(c1cnn(C)c1)c1ccc(C)c(-c2cc(F)cc([N+](=O)[O-])c2)n1.[2H]C([2H])(c1cnn(C)c1)c1ccc(C)c(-c2cc(F)cc([N+](=O)[O-])c2)n1.[2H]C([2H])(c1cnn(C)c1)c1ccc(C)c(-c2cc(F)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/3C17H15FN4O2/c3*1-11-3-4-15(5-12-9-19-21(2)10-12)20-17(11)13-6-14(18)8-16(7-13)22(23)24/h3*3-4,6-10H,5H2,1-2H3/i3*5D2 |
| InChIKey | OGOQNRRHPFBBHY-MLMBUTNTSA-N |
| XLogP | 10.29 |
| TPSA | 221.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 985.03 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|