C25H26FN3O2S — CID 15999726
[3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 15999726) has the molecular formula C25H26FN3O2S and a molecular weight of 451.57 g/mol. Its IUPAC name is [3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 15999726 |
| Molecular Formula | C25H26FN3O2S |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-[4-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(N2CCN(C(=O)c3ccc(SCc4cccc(F)c4)c(N)c3)CC2)cc1 |
| InChI | InChI=1S/C25H26FN3O2S/c1-31-22-8-6-21(7-9-22)28-11-13-29(14-12-28)25(30)19-5-10-24(23(27)16-19)32-17-18-3-2-4-20(26)15-18/h2-10,15-16H,11-14,17,27H2,1H3 |
| InChIKey | OFDKLRSCRRMOKW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|