C19H21FN2OS — CID 4159328
[3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-piperidin-1-ylmethanone (PubChem CID 4159328) has the molecular formula C19H21FN2OS and a molecular weight of 344.46 g/mol. Its IUPAC name is [3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 4159328 |
| Molecular Formula | C19H21FN2OS |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | [3-amino-4-[(3-fluorophenyl)methylsulfanyl]phenyl]-piperidin-1-ylmethanone |
| SMILES | Nc1cc(C(=O)N2CCCCC2)ccc1SCc1cccc(F)c1 |
| InChI | InChI=1S/C19H21FN2OS/c20-16-6-4-5-14(11-16)13-24-18-8-7-15(12-17(18)21)19(23)22-9-2-1-3-10-22/h4-8,11-12H,1-3,9-10,13,21H2 |
| InChIKey | SVNMTMZNSGGONP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|