C27H17NO6S — CID 15999781
[3-(1,3-dioxoisoindol-2-yl)phenyl] 4-(benzenesulfonyl)benzoate (PubChem CID 15999781) has the molecular formula C27H17NO6S and a molecular weight of 483.50 g/mol. Its IUPAC name is [3-(1,3-dioxoisoindol-2-yl)phenyl] 4-(benzenesulfonyl)benzoate.
| Compound Name | [3-(1,3-dioxoisoindol-2-yl)phenyl] 4-(benzenesulfonyl)benzoate |
|---|---|
| PubChem CID | 15999781 |
| Molecular Formula | C27H17NO6S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | [3-(1,3-dioxoisoindol-2-yl)phenyl] 4-(benzenesulfonyl)benzoate |
| SMILES | O=C(Oc1cccc(N2C(=O)c3ccccc3C2=O)c1)c1ccc(S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H17NO6S/c29-25-23-11-4-5-12-24(23)26(30)28(25)19-7-6-8-20(17-19)34-27(31)18-13-15-22(16-14-18)35(32,33)21-9-2-1-3-10-21/h1-17H |
| InChIKey | IDJIMANIXKLLGJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|