C19H21F2N3O2 — CID 160500533
[(2S)-1-(3,4-dimethylbenzoyl)-4,4-difluoropyrrolidin-2-yl]-[(2R)-2-isocyanopyrrolidin-1-yl]methanone (PubChem CID 160500533) has the molecular formula C19H21F2N3O2 and a molecular weight of 361.39 g/mol. Its IUPAC name is [(2S)-1-(3,4-dimethylbenzoyl)-4,4-difluoropyrrolidin-2-yl]-[(2R)-2-isocyanopyrrolidin-1-yl]methanone.
| Compound Name | [(2S)-1-(3,4-dimethylbenzoyl)-4,4-difluoropyrrolidin-2-yl]-[(2R)-2-isocyanopyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 160500533 |
| Molecular Formula | C19H21F2N3O2 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [(2S)-1-(3,4-dimethylbenzoyl)-4,4-difluoropyrrolidin-2-yl]-[(2R)-2-isocyanopyrrolidin-1-yl]methanone |
| SMILES | [C-]#[N+][C@@H]1CCCN1C(=O)[C@@H]1CC(F)(F)CN1C(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H21F2N3O2/c1-12-6-7-14(9-13(12)2)17(25)24-11-19(20,21)10-15(24)18(26)23-8-4-5-16(23)22-3/h6-7,9,15-16H,4-5,8,10-11H2,1-2H3/t15-,16-/m0/s1 |
| InChIKey | QRSLKFHPEIAEOB-HOTGVXAUSA-N |
| XLogP | 3.02 |
| TPSA | 44.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|