About 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate
2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate (PubChem CID 160501540) has the molecular formula C14H32N2O5S2
and a molecular weight of 372.55 g/mol. Its IUPAC name is 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate |
| PubChem CID | 160501540 |
| Molecular Formula | C14H32N2O5S2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate |
| SMILES | CO.COC(=O)C(CSC)N(C)C.CSCC(C(=O)O)N(C)C |
| InChI | InChI=1S/C7H15NO2S.C6H13NO2S.CH4O/c1-8(2)6(5-11-4)7(9)10-3;1-7(2)5(4-10-3)6(8)9;1-2/h6H,5H2,1-4H3;5H,4H2,1-3H3,(H,8,9);2H,1H3 |
| InChIKey | QRVRORUHTQGWPP-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate?
The IUPAC name of 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate (CID 160501540) is 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate.
What is the SMILES notation for 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate?
The canonical SMILES for 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate is CO.COC(=O)C(CSC)N(C)C.CSCC(C(=O)O)N(C)C.
What is the InChIKey of 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate?
The InChIKey is QRVRORUHTQGWPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2S.C6H13NO2S.CH4O/c1-8(2)6(5-11-4)7(9)10-3;1-7(2)5(4-10-3)6(8)9;1-2/h6H,5H2,1-4H3;5H,4H2,1-3H3,(H,8,9);2H,1H3.
What are the key properties of 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate?
2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate has a molecular weight of 372.55 g/mol, XLogP of 0.43, 8 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)-3-methylsulfanylpropanoic acid;methanol;methyl 2-(dimethylamino)-3-methylsulfanylpropanoate is sourced from PubChem (CID 160501540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).