C12H16F3N3O4 — CID 160507427
carbon dioxide;1-methyl-3-[(2R)-3-methyl-1-nitropentan-2-yl]-5-(trifluoromethyl)pyrazole (PubChem CID 160507427) has the molecular formula C12H16F3N3O4 and a molecular weight of 323.27 g/mol. Its IUPAC name is carbon dioxide;1-methyl-3-[(2R)-3-methyl-1-nitropentan-2-yl]-5-(trifluoromethyl)pyrazole.
| Compound Name | carbon dioxide;1-methyl-3-[(2R)-3-methyl-1-nitropentan-2-yl]-5-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 160507427 |
| Molecular Formula | C12H16F3N3O4 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | carbon dioxide;1-methyl-3-[(2R)-3-methyl-1-nitropentan-2-yl]-5-(trifluoromethyl)pyrazole |
| SMILES | CCC(C)[C@H](C[N+](=O)[O-])c1cc(C(F)(F)F)n(C)n1.O=C=O |
| InChI | InChI=1S/C11H16F3N3O2.CO2/c1-4-7(2)8(6-17(18)19)9-5-10(11(12,13)14)16(3)15-9;2-1-3/h5,7-8H,4,6H2,1-3H3;/t7?,8-;/m0./s1 |
| InChIKey | QSPCPRWZGDTQSS-MTICXXPYSA-N |
| XLogP | 2.26 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|