C26H33N3 — CID 160508334
8-tert-butyl-2-methylidene-1H-quinoline;3-tert-butyl-1-methylindazole (PubChem CID 160508334) has the molecular formula C26H33N3 and a molecular weight of 387.57 g/mol. Its IUPAC name is 8-tert-butyl-2-methylidene-1H-quinoline;3-tert-butyl-1-methylindazole.
| Compound Name | 8-tert-butyl-2-methylidene-1H-quinoline;3-tert-butyl-1-methylindazole |
|---|---|
| PubChem CID | 160508334 |
| Molecular Formula | C26H33N3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | 8-tert-butyl-2-methylidene-1H-quinoline;3-tert-butyl-1-methylindazole |
| SMILES | C=C1C=Cc2cccc(C(C)(C)C)c2N1.Cn1nc(C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C14H17N.C12H16N2/c1-10-8-9-11-6-5-7-12(13(11)15-10)14(2,3)4;1-12(2,3)11-9-7-5-6-8-10(9)14(4)13-11/h5-9,15H,1H2,2-4H3;5-8H,1-4H3 |
| InChIKey | QSSDMNPDFUNELJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |