C21H16ClNO4S — CID 160512892
3-[3-[4-[(3-chlorophenyl)methoxy]phenyl]sulfanylfuran-2-yl]pyrrolidine-2,5-dione (PubChem CID 160512892) has the molecular formula C21H16ClNO4S and a molecular weight of 413.88 g/mol. Its IUPAC name is 3-[3-[4-[(3-chlorophenyl)methoxy]phenyl]sulfanylfuran-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 3-[3-[4-[(3-chlorophenyl)methoxy]phenyl]sulfanylfuran-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 160512892 |
| Molecular Formula | C21H16ClNO4S |
| Molecular Weight | 413.88 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 3-[3-[4-[(3-chlorophenyl)methoxy]phenyl]sulfanylfuran-2-yl]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2occc2Sc2ccc(OCc3cccc(Cl)c3)cc2)C(=O)N1 |
| InChI | InChI=1S/C21H16ClNO4S/c22-14-3-1-2-13(10-14)12-27-15-4-6-16(7-5-15)28-18-8-9-26-20(18)17-11-19(24)23-21(17)25/h1-10,17H,11-12H2,(H,23,24,25) |
| InChIKey | CXYAXFPGUHOUSZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.88 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|