C21H15F3N2O4S — CID 67176968
5-[3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione (PubChem CID 67176968) has the molecular formula C21H15F3N2O4S and a molecular weight of 448.42 g/mol. Its IUPAC name is 5-[3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 67176968 |
| Molecular Formula | C21H15F3N2O4S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 5-[3-[4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]sulfanylfuran-2-yl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2occc2Sc2ccc(OCc3cccc(C(F)(F)F)c3)cc2)N1 |
| InChI | InChI=1S/C21H15F3N2O4S/c22-21(23,24)13-3-1-2-12(10-13)11-30-14-4-6-15(7-5-14)31-16-8-9-29-18(16)17-19(27)26-20(28)25-17/h1-10,17H,11H2,(H2,25,26,27,28) |
| InChIKey | DXZLSSFQUPNXRE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|