C20H19N5O3S — CID 146263030
5-[1-methyl-5-[4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanylimidazol-4-yl]imidazolidine-2,4-dione (PubChem CID 146263030) has the molecular formula C20H19N5O3S and a molecular weight of 409.47 g/mol. Its IUPAC name is 5-[1-methyl-5-[4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanylimidazol-4-yl]imidazolidine-2,4-dione.
| Compound Name | 5-[1-methyl-5-[4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanylimidazol-4-yl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146263030 |
| Molecular Formula | C20H19N5O3S |
| Molecular Weight | 409.47 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-[1-methyl-5-[4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanylimidazol-4-yl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(COc2ccc(Sc3c(C4NC(=O)NC4=O)ncn3C)cc2)ccn1 |
| InChI | InChI=1S/C20H19N5O3S/c1-12-9-13(7-8-21-12)10-28-14-3-5-15(6-4-14)29-19-17(22-11-25(19)2)16-18(26)24-20(27)23-16/h3-9,11,16H,10H2,1-2H3,(H2,23,24,26,27) |
| InChIKey | HIUGBYRGXVBQTN-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|