C21H17FN4O3S — CID 146262966
5-[4-[2-fluoro-4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 146262966) has the molecular formula C21H17FN4O3S and a molecular weight of 424.46 g/mol. Its IUPAC name is 5-[4-[2-fluoro-4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-[2-fluoro-4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146262966 |
| Molecular Formula | C21H17FN4O3S |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 5-[4-[2-fluoro-4-[(2-methyl-4-pyridinyl)methoxy]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | Cc1cc(COc2ccc(Sc3ccncc3C3NC(=O)NC3=O)c(F)c2)ccn1 |
| InChI | InChI=1S/C21H17FN4O3S/c1-12-8-13(4-7-24-12)11-29-14-2-3-18(16(22)9-14)30-17-5-6-23-10-15(17)19-20(27)26-21(28)25-19/h2-10,19H,11H2,1H3,(H2,25,26,27,28) |
| InChIKey | HKKVAUZCGNRBNA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|