C22H19N3O4S — CID 146263079
5-[3-[4-[[3-(hydroxymethyl)phenyl]methoxy]phenyl]sulfanyl-4-pyridinyl]imidazolidine-2,4-dione (PubChem CID 146263079) has the molecular formula C22H19N3O4S and a molecular weight of 421.48 g/mol. Its IUPAC name is 5-[3-[4-[[3-(hydroxymethyl)phenyl]methoxy]phenyl]sulfanyl-4-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 5-[3-[4-[[3-(hydroxymethyl)phenyl]methoxy]phenyl]sulfanyl-4-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146263079 |
| Molecular Formula | C22H19N3O4S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 5-[3-[4-[[3-(hydroxymethyl)phenyl]methoxy]phenyl]sulfanyl-4-pyridinyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)C(c2ccncc2Sc2ccc(OCc3cccc(CO)c3)cc2)N1 |
| InChI | InChI=1S/C22H19N3O4S/c26-12-14-2-1-3-15(10-14)13-29-16-4-6-17(7-5-16)30-19-11-23-9-8-18(19)20-21(27)25-22(28)24-20/h1-11,20,26H,12-13H2,(H2,24,25,27,28) |
| InChIKey | WDSIYYDSHPQZAO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|