C22H19N3O3S — CID 146263009
5-[4-[4-[(3-methylphenoxy)methyl]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione (PubChem CID 146263009) has the molecular formula C22H19N3O3S and a molecular weight of 405.48 g/mol. Its IUPAC name is 5-[4-[4-[(3-methylphenoxy)methyl]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-[4-[(3-methylphenoxy)methyl]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146263009 |
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | 5-[4-[4-[(3-methylphenoxy)methyl]phenyl]sulfanyl-3-pyridinyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(OCc2ccc(Sc3ccncc3C3NC(=O)NC3=O)cc2)c1 |
| InChI | InChI=1S/C22H19N3O3S/c1-14-3-2-4-16(11-14)28-13-15-5-7-17(8-6-15)29-19-9-10-23-12-18(19)20-21(26)25-22(27)24-20/h2-12,20H,13H2,1H3,(H2,24,25,26,27) |
| InChIKey | NFYROKIREIZNNM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|