C8H11ClN2O4S — CID 160516087
2-chloropyridine-3-sulfonic acid;N,N-dimethylformamide (PubChem CID 160516087) has the molecular formula C8H11ClN2O4S and a molecular weight of 266.71 g/mol. Its IUPAC name is 2-chloropyridine-3-sulfonic acid;N,N-dimethylformamide.
| Compound Name | 2-chloropyridine-3-sulfonic acid;N,N-dimethylformamide |
|---|---|
| PubChem CID | 160516087 |
| Molecular Formula | C8H11ClN2O4S |
| Molecular Weight | 266.71 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 2-chloropyridine-3-sulfonic acid;N,N-dimethylformamide |
| SMILES | CN(C)C=O.O=S(=O)(O)c1cccnc1Cl |
| InChI | InChI=1S/C5H4ClNO3S.C3H7NO/c6-5-4(11(8,9)10)2-1-3-7-5;1-4(2)3-5/h1-3H,(H,8,9,10);3H,1-2H3 |
| InChIKey | QTRFLVBSRORIBK-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.71 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|