C17H27NS — CID 160521762
(3S,4R)-4-methyl-3-phenylsulfanyl-N-prop-2-enylheptan-3-amine (PubChem CID 160521762) has the molecular formula C17H27NS and a molecular weight of 277.48 g/mol. Its IUPAC name is (3S,4R)-4-methyl-3-phenylsulfanyl-N-prop-2-enylheptan-3-amine.
| Compound Name | (3S,4R)-4-methyl-3-phenylsulfanyl-N-prop-2-enylheptan-3-amine |
|---|---|
| PubChem CID | 160521762 |
| Molecular Formula | C17H27NS |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | (3S,4R)-4-methyl-3-phenylsulfanyl-N-prop-2-enylheptan-3-amine |
| SMILES | C=CCN[C@@](CC)(Sc1ccccc1)[C@H](C)CCC |
| InChI | InChI=1S/C17H27NS/c1-5-11-15(4)17(7-3,18-14-6-2)19-16-12-9-8-10-13-16/h6,8-10,12-13,15,18H,2,5,7,11,14H2,1,3-4H3/t15-,17+/m1/s1 |
| InChIKey | TYNBEXPLQFBXCE-WBVHZDCISA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|