About carbamic acid;methyl prop-2-eneperoxoate
carbamic acid;methyl prop-2-eneperoxoate (PubChem CID 160528403) has the molecular formula C5H9NO5
and a molecular weight of 163.13 g/mol. Its IUPAC name is carbamic acid;methyl prop-2-eneperoxoate.
Molecular Properties
| Compound Name | carbamic acid;methyl prop-2-eneperoxoate |
| PubChem CID | 160528403 |
| Molecular Formula | C5H9NO5 |
| Molecular Weight | 163.13 g/mol |
| Exact Mass | 163.05 |
| IUPAC Name | carbamic acid;methyl prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOC.NC(=O)O |
| InChI | InChI=1S/C4H6O3.CH3NO2/c1-3-4(5)7-6-2;2-1(3)4/h3H,1H2,2H3;2H2,(H,3,4) |
| InChIKey | QVFBMVMJSARBLM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.13 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;methyl prop-2-eneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;methyl prop-2-eneperoxoate?
The IUPAC name of carbamic acid;methyl prop-2-eneperoxoate (CID 160528403) is carbamic acid;methyl prop-2-eneperoxoate.
What is the SMILES notation for carbamic acid;methyl prop-2-eneperoxoate?
The canonical SMILES for carbamic acid;methyl prop-2-eneperoxoate is C=CC(=O)OOC.NC(=O)O.
What is the InChIKey of carbamic acid;methyl prop-2-eneperoxoate?
The InChIKey is QVFBMVMJSARBLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.CH3NO2/c1-3-4(5)7-6-2;2-1(3)4/h3H,1H2,2H3;2H2,(H,3,4).
What are the key properties of carbamic acid;methyl prop-2-eneperoxoate?
carbamic acid;methyl prop-2-eneperoxoate has a molecular weight of 163.13 g/mol, XLogP of -0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;methyl prop-2-eneperoxoate is sourced from PubChem (CID 160528403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).