C42H74N4O12Si4 — CID 160528749
(2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-[2,4,5-tris(2,2-diethyl-1,3,6,2-dioxazasilocane-6-carbonyl)phenyl]methanone (PubChem CID 160528749) has the molecular formula C42H74N4O12Si4 and a molecular weight of 939.41 g/mol. Its IUPAC name is (2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-[2,4,5-tris(2,2-diethyl-1,3,6,2-dioxazasilocane-6-carbonyl)phenyl]methanone.
| Compound Name | (2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-[2,4,5-tris(2,2-diethyl-1,3,6,2-dioxazasilocane-6-carbonyl)phenyl]methanone |
|---|---|
| PubChem CID | 160528749 |
| Molecular Formula | C42H74N4O12Si4 |
| Molecular Weight | 939.41 g/mol |
| Exact Mass | 938.44 |
| IUPAC Name | (2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-[2,4,5-tris(2,2-diethyl-1,3,6,2-dioxazasilocane-6-carbonyl)phenyl]methanone |
| SMILES | CC[Si]1(CC)OCCN(C(=O)c2cc(C(=O)N3CCO[Si](CC)(CC)OCC3)c(C(=O)N3CCO[Si](CC)(CC)OCC3)cc2C(=O)N2CCO[Si](CC)(CC)OCC2)CCO1 |
| InChI | InChI=1S/C42H74N4O12Si4/c1-9-59(10-2)51-25-17-43(18-26-52-59)39(47)35-33-37(41(49)45-21-29-55-61(13-5,14-6)56-30-22-45)38(42(50)46-23-31-57-62(15-7,16-8)58-32-24-46)34-36(35)40(48)44-19-27-53-60(11-3,12-4)54-28-20-44/h33-34H,9-32H2,1-8H3 |
| InChIKey | JIUHISFFZHHENQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 155.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 939.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|