C21H42N2O6Si2 — CID 161133697
1-(2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-6-(2-ethyl-2-methyl-1,3,6,2-dioxazasilocan-6-yl)hexane-1,6-dione (PubChem CID 161133697) has the molecular formula C21H42N2O6Si2 and a molecular weight of 474.75 g/mol. Its IUPAC name is 1-(2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-6-(2-ethyl-2-methyl-1,3,6,2-dioxazasilocan-6-yl)hexane-1,6-dione.
| Compound Name | 1-(2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-6-(2-ethyl-2-methyl-1,3,6,2-dioxazasilocan-6-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 161133697 |
| Molecular Formula | C21H42N2O6Si2 |
| Molecular Weight | 474.75 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 1-(2,2-diethyl-1,3,6,2-dioxazasilocan-6-yl)-6-(2-ethyl-2-methyl-1,3,6,2-dioxazasilocan-6-yl)hexane-1,6-dione |
| SMILES | CC[Si]1(C)OCCN(C(=O)CCCCC(=O)N2CCO[Si](CC)(CC)OCC2)CCO1 |
| InChI | InChI=1S/C21H42N2O6Si2/c1-5-30(4)26-16-12-22(13-17-27-30)20(24)10-8-9-11-21(25)23-14-18-28-31(6-2,7-3)29-19-15-23/h5-19H2,1-4H3 |
| InChIKey | ZNLXTKOJXSDQOX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|