About bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole
bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole (PubChem CID 160529922) has the molecular formula C21H14F3Ir2N3-2
and a molecular weight of 749.79 g/mol. Its IUPAC name is bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole.
Molecular Properties
| Compound Name | bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole |
| PubChem CID | 160529922 |
| Molecular Formula | C21H14F3Ir2N3-2 |
| Molecular Weight | 749.79 g/mol |
| Exact Mass | 751.04 |
| IUPAC Name | bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole |
| SMILES | FC(F)(F)c1c[c-]c(-n2cccn2)cc1.[Ir].[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C11H8N.C10H6F3N2.2Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;11-10(12,13)8-2-4-9(5-3-8)15-7-1-6-14-15;;/h1-6,8-9H;1-4,6-7H;;/q2*-1;; |
| InChIKey | HDPIJLWSUNJNCT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 749.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
The IUPAC name of bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole (CID 160529922) is bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole.
What is the SMILES notation for bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
The canonical SMILES for bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole is FC(F)(F)c1c[c-]c(-n2cccn2)cc1.[Ir].[Ir].[c-]1ccccc1-c1ccccn1.
What is the InChIKey of bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
The InChIKey is HDPIJLWSUNJNCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N.C10H6F3N2.2Ir/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;11-10(12,13)8-2-4-9(5-3-8)15-7-1-6-14-15;;/h1-6,8-9H;1-4,6-7H;;/q2*-1;;.
What are the key properties of bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole?
bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole has a molecular weight of 749.79 g/mol, XLogP of 5.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(iridium);2-phenylpyridine;1-[4-(trifluoromethyl)benzene-6-id-1-yl]pyrazole is sourced from PubChem (CID 160529922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).