C11H25N5 — CID 160540133
N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine;hydrazine (PubChem CID 160540133) has the molecular formula C11H25N5 and a molecular weight of 227.36 g/mol. Its IUPAC name is N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine;hydrazine.
| Compound Name | N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine;hydrazine |
|---|---|
| PubChem CID | 160540133 |
| Molecular Formula | C11H25N5 |
| Molecular Weight | 227.36 g/mol |
| Exact Mass | 227.21 |
| IUPAC Name | N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine;hydrazine |
| SMILES | CCN(CC)N(N)C1(CC)C=CC=C1.NN |
| InChI | InChI=1S/C11H21N3.H4N2/c1-4-11(9-7-8-10-11)14(12)13(5-2)6-3;1-2/h7-10H,4-6,12H2,1-3H3;1-2H2 |
| InChIKey | QWRFHFKXVJXEIU-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.36 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|