C8H15N3 — CID 159138820
N-amino-N-(dimethylamino)-1-methylcyclopenta-2,4-dien-1-amine (PubChem CID 159138820) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is N-amino-N-(dimethylamino)-1-methylcyclopenta-2,4-dien-1-amine.
| Compound Name | N-amino-N-(dimethylamino)-1-methylcyclopenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 159138820 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | N-amino-N-(dimethylamino)-1-methylcyclopenta-2,4-dien-1-amine |
| SMILES | CN(C)N(N)C1(C)C=CC=C1 |
| InChI | InChI=1S/C8H15N3/c1-8(6-4-5-7-8)11(9)10(2)3/h4-7H,9H2,1-3H3 |
| InChIKey | PPKUIVRGOVMZKE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|