C14H20N2 — CID 150059268
1,2-dimethyl-1,2-bis(1-methylcyclopenta-2,4-dien-1-yl)hydrazine (PubChem CID 150059268) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 1,2-dimethyl-1,2-bis(1-methylcyclopenta-2,4-dien-1-yl)hydrazine.
| Compound Name | 1,2-dimethyl-1,2-bis(1-methylcyclopenta-2,4-dien-1-yl)hydrazine |
|---|---|
| PubChem CID | 150059268 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 1,2-dimethyl-1,2-bis(1-methylcyclopenta-2,4-dien-1-yl)hydrazine |
| SMILES | CN(N(C)C1(C)C=CC=C1)C1(C)C=CC=C1 |
| InChI | InChI=1S/C14H20N2/c1-13(9-5-6-10-13)15(3)16(4)14(2)11-7-8-12-14/h5-12H,1-4H3 |
| InChIKey | DMYJWNVCHRGSFN-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|