C11H21N3 — CID 160540134
N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine (PubChem CID 160540134) has the molecular formula C11H21N3 and a molecular weight of 195.31 g/mol. Its IUPAC name is N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine.
| Compound Name | N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 160540134 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | N-amino-N-(diethylamino)-1-ethylcyclopenta-2,4-dien-1-amine |
| SMILES | CCN(CC)N(N)C1(CC)C=CC=C1 |
| InChI | InChI=1S/C11H21N3/c1-4-11(9-7-8-10-11)14(12)13(5-2)6-3/h7-10H,4-6,12H2,1-3H3 |
| InChIKey | XMEIMYIQOPDFOG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|