About 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid
1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid (PubChem CID 160549881) has the molecular formula C30H34BIO2
and a molecular weight of 564.32 g/mol. Its IUPAC name is 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid.
Molecular Properties
| Compound Name | 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid |
| PubChem CID | 160549881 |
| Molecular Formula | C30H34BIO2 |
| Molecular Weight | 564.32 g/mol |
| Exact Mass | 564.17 |
| IUPAC Name | 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid |
| SMILES | CCc1ccccc1-c1ccc(C)cc1.CCc1ccccc1I.Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C15H16.C8H9I.C7H9BO2/c1-3-13-6-4-5-7-15(13)14-10-8-12(2)9-11-14;1-2-7-5-3-4-6-8(7)9;1-6-2-4-7(5-3-6)8(9)10/h4-11H,3H2,1-2H3;3-6H,2H2,1H3;2-5,9-10H,1H3 |
| InChIKey | QXXONNFVXTYJJV-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 564.32 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid?
The IUPAC name of 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid (CID 160549881) is 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid.
What is the SMILES notation for 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid?
The canonical SMILES for 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid is CCc1ccccc1-c1ccc(C)cc1.CCc1ccccc1I.Cc1ccc(B(O)O)cc1.
What is the InChIKey of 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid?
The InChIKey is QXXONNFVXTYJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16.C8H9I.C7H9BO2/c1-3-13-6-4-5-7-15(13)14-10-8-12(2)9-11-14;1-2-7-5-3-4-6-8(7)9;1-6-2-4-7(5-3-6)8(9)10/h4-11H,3H2,1-2H3;3-6H,2H2,1H3;2-5,9-10H,1H3.
What are the key properties of 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid?
1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid has a molecular weight of 564.32 g/mol, XLogP of 6.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-iodobenzene;1-ethyl-2-(4-methylphenyl)benzene;(4-methylphenyl)boronic acid is sourced from PubChem (CID 160549881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).