About N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane
N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane (PubChem CID 160553330) has the molecular formula C14H21NO3S2
and a molecular weight of 315.46 g/mol. Its IUPAC name is N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane.
Molecular Properties
| Compound Name | N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane |
| PubChem CID | 160553330 |
| Molecular Formula | C14H21NO3S2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane |
| SMILES | CC(=O)[C@H]1CCOC[C@H]1NC(=O)c1ccccc1.S.S |
| InChI | InChI=1S/C14H17NO3.2H2S/c1-10(16)12-7-8-18-9-13(12)15-14(17)11-5-3-2-4-6-11;;/h2-6,12-13H,7-9H2,1H3,(H,15,17);2*1H2/t12-,13-;;/m1../s1 |
| InChIKey | QYIYZZLFPYHTNJ-SNFSYSBXSA-N |
| XLogP | 1.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane?
The IUPAC name of N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane (CID 160553330) is N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane.
What is the SMILES notation for N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane?
The canonical SMILES for N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane is CC(=O)[C@H]1CCOC[C@H]1NC(=O)c1ccccc1.S.S.
What is the InChIKey of N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane?
The InChIKey is QYIYZZLFPYHTNJ-SNFSYSBXSA-N. The full InChI is InChI=1S/C14H17NO3.2H2S/c1-10(16)12-7-8-18-9-13(12)15-14(17)11-5-3-2-4-6-11;;/h2-6,12-13H,7-9H2,1H3,(H,15,17);2*1H2/t12-,13-;;/m1../s1.
What are the key properties of N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane?
N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane has a molecular weight of 315.46 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3S,4S)-4-acetyloxan-3-yl]benzamide;sulfane is sourced from PubChem (CID 160553330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).