About cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide
cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide (PubChem CID 160555328) has the molecular formula C18H34N2O3
and a molecular weight of 326.48 g/mol. Its IUPAC name is cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide.
Molecular Properties
| Compound Name | cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide |
| PubChem CID | 160555328 |
| Molecular Formula | C18H34N2O3 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide |
| SMILES | CCCCCC(N)=O.O=C1CCCCC1.ON=C1CCCCC1 |
| InChI | InChI=1S/C6H11NO.C6H13NO.C6H10O/c8-7-6-4-2-1-3-5-6;1-2-3-4-5-6(7)8;7-6-4-2-1-3-5-6/h8H,1-5H2;2-5H2,1H3,(H2,7,8);1-5H2 |
| InChIKey | QYPMABDHEHPNDH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide?
The IUPAC name of cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide (CID 160555328) is cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide.
What is the SMILES notation for cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide?
The canonical SMILES for cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide is CCCCCC(N)=O.O=C1CCCCC1.ON=C1CCCCC1.
What is the InChIKey of cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide?
The InChIKey is QYPMABDHEHPNDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO.C6H13NO.C6H10O/c8-7-6-4-2-1-3-5-6;1-2-3-4-5-6(7)8;7-6-4-2-1-3-5-6/h8H,1-5H2;2-5H2,1H3,(H2,7,8);1-5H2.
What are the key properties of cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide?
cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide has a molecular weight of 326.48 g/mol, XLogP of 4.35, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanone;N-cyclohexylidenehydroxylamine;hexanamide is sourced from PubChem (CID 160555328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).