C23H48N2O3 — CID 174892658
N,N-dimethylpropan-1-amine;dodecanamide;oxepan-2-one (PubChem CID 174892658) has the molecular formula C23H48N2O3 and a molecular weight of 400.65 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;dodecanamide;oxepan-2-one.
| Compound Name | N,N-dimethylpropan-1-amine;dodecanamide;oxepan-2-one |
|---|---|
| PubChem CID | 174892658 |
| Molecular Formula | C23H48N2O3 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.37 |
| IUPAC Name | N,N-dimethylpropan-1-amine;dodecanamide;oxepan-2-one |
| SMILES | CCCCCCCCCCCC(N)=O.CCCN(C)C.O=C1CCCCCO1 |
| InChI | InChI=1S/C12H25NO.C6H10O2.C5H13N/c1-2-3-4-5-6-7-8-9-10-11-12(13)14;7-6-4-2-1-3-5-8-6;1-4-5-6(2)3/h2-11H2,1H3,(H2,13,14);1-5H2;4-5H2,1-3H3 |
| InChIKey | PSDSGPHTXDGVLA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|