C30H30N6O4 — CID 160555600
benzyl N-(3-amino-4-methylphenyl)carbamate;benzyl N-(3-azido-4-methylphenyl)carbamate (PubChem CID 160555600) has the molecular formula C30H30N6O4 and a molecular weight of 538.61 g/mol. Its IUPAC name is benzyl N-(3-amino-4-methylphenyl)carbamate;benzyl N-(3-azido-4-methylphenyl)carbamate.
| Compound Name | benzyl N-(3-amino-4-methylphenyl)carbamate;benzyl N-(3-azido-4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 160555600 |
| Molecular Formula | C30H30N6O4 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.23 |
| IUPAC Name | benzyl N-(3-amino-4-methylphenyl)carbamate;benzyl N-(3-azido-4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)OCc2ccccc2)cc1N.Cc1ccc(NC(=O)OCc2ccccc2)cc1N=[N+]=[N-] |
| InChI | InChI=1S/C15H14N4O2.C15H16N2O2/c1-11-7-8-13(9-14(11)18-19-16)17-15(20)21-10-12-5-3-2-4-6-12;1-11-7-8-13(9-14(11)16)17-15(18)19-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,17,20);2-9H,10,16H2,1H3,(H,17,18) |
| InChIKey | QYQIJTBOHQCDDM-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 151.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|