About 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane
1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane (PubChem CID 160557443) has the molecular formula C20H44
and a molecular weight of 284.57 g/mol. Its IUPAC name is 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane.
Molecular Properties
| Compound Name | 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane |
| PubChem CID | 160557443 |
| Molecular Formula | C20H44 |
| Molecular Weight | 284.57 g/mol |
| Exact Mass | 284.34 |
| IUPAC Name | 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane |
| SMILES | C.C.CC(C)C1(C(C)C)CC1.CC(C)C1CC1C(C)C |
| InChI | InChI=1S/2C9H18.2CH4/c1-7(2)9(5-6-9)8(3)4;1-6(2)8-5-9(8)7(3)4;;/h7-8H,5-6H2,1-4H3;6-9H,5H2,1-4H3;2*1H4 |
| InChIKey | QYWGESPAVHAJGQ-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.57 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane?
The IUPAC name of 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane (CID 160557443) is 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane.
What is the SMILES notation for 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane?
The canonical SMILES for 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane is C.C.CC(C)C1(C(C)C)CC1.CC(C)C1CC1C(C)C.
What is the InChIKey of 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane?
The InChIKey is QYWGESPAVHAJGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C9H18.2CH4/c1-7(2)9(5-6-9)8(3)4;1-6(2)8-5-9(8)7(3)4;;/h7-8H,5-6H2,1-4H3;6-9H,5H2,1-4H3;2*1H4.
What are the key properties of 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane?
1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane has a molecular weight of 284.57 g/mol, XLogP of 7.29, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-di(propan-2-yl)cyclopropane;1,2-di(propan-2-yl)cyclopropane;methane is sourced from PubChem (CID 160557443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).