C17H34 — CID 164960438
(E)-2,5-dimethylhex-3-ene;1,2-di(propan-2-yl)cyclopropane (PubChem CID 164960438) has the molecular formula C17H34 and a molecular weight of 238.46 g/mol. Its IUPAC name is (E)-2,5-dimethylhex-3-ene;1,2-di(propan-2-yl)cyclopropane.
| Compound Name | (E)-2,5-dimethylhex-3-ene;1,2-di(propan-2-yl)cyclopropane |
|---|---|
| PubChem CID | 164960438 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | (E)-2,5-dimethylhex-3-ene;1,2-di(propan-2-yl)cyclopropane |
| SMILES | CC(C)/C=C/C(C)C.CC(C)C1CC1C(C)C |
| InChI | InChI=1S/C9H18.C8H16/c1-6(2)8-5-9(8)7(3)4;1-7(2)5-6-8(3)4/h6-9H,5H2,1-4H3;5-8H,1-4H3/b;6-5+ |
| InChIKey | BTMLURCGSJUVEJ-MXDQRGINSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|