C31H44N2O8S — CID 160561579
benzyl (3S)-3-[(1R)-1-hydroxyethyl]piperidine-1-carboxylate;benzyl (3S)-3-[(1R)-1-methylsulfonyloxyethyl]piperidine-1-carboxylate (PubChem CID 160561579) has the molecular formula C31H44N2O8S and a molecular weight of 604.77 g/mol. Its IUPAC name is benzyl (3S)-3-[(1R)-1-hydroxyethyl]piperidine-1-carboxylate;benzyl (3S)-3-[(1R)-1-methylsulfonyloxyethyl]piperidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[(1R)-1-hydroxyethyl]piperidine-1-carboxylate;benzyl (3S)-3-[(1R)-1-methylsulfonyloxyethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 160561579 |
| Molecular Formula | C31H44N2O8S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | benzyl (3S)-3-[(1R)-1-hydroxyethyl]piperidine-1-carboxylate;benzyl (3S)-3-[(1R)-1-methylsulfonyloxyethyl]piperidine-1-carboxylate |
| SMILES | C[C@@H](O)[C@H]1CCCN(C(=O)OCc2ccccc2)C1.C[C@@H](OS(C)(=O)=O)[C@H]1CCCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H23NO5S.C15H21NO3/c1-13(22-23(2,19)20)15-9-6-10-17(11-15)16(18)21-12-14-7-4-3-5-8-14;1-12(17)14-8-5-9-16(10-14)15(18)19-11-13-6-3-2-4-7-13/h3-5,7-8,13,15H,6,9-12H2,1-2H3;2-4,6-7,12,14,17H,5,8-11H2,1H3/t13-,15+;12-,14+/m11/s1 |
| InChIKey | QZJPMNJMFAHHJL-CQEMVKSESA-N |
| XLogP | 4.82 |
| TPSA | 122.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|