C16H24N2O3 — CID 71649005
benzyl 3-(1-amino-3-hydroxypropyl)piperidine-1-carboxylate (PubChem CID 71649005) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is benzyl 3-(1-amino-3-hydroxypropyl)piperidine-1-carboxylate.
| Compound Name | benzyl 3-(1-amino-3-hydroxypropyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71649005 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | benzyl 3-(1-amino-3-hydroxypropyl)piperidine-1-carboxylate |
| SMILES | NC(CCO)C1CCCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H24N2O3/c17-15(8-10-19)14-7-4-9-18(11-14)16(20)21-12-13-5-2-1-3-6-13/h1-3,5-6,14-15,19H,4,7-12,17H2 |
| InChIKey | HMQZLRKDQYWCSG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |