C19H27N2O4S- — CID 174571620
(1-phenylmethoxycarbonylpiperidin-3-yl)-piperidin-1-ylmethanesulfinate (PubChem CID 174571620) has the molecular formula C19H27N2O4S- and a molecular weight of 379.50 g/mol. Its IUPAC name is (1-phenylmethoxycarbonylpiperidin-3-yl)-piperidin-1-ylmethanesulfinate.
| Compound Name | (1-phenylmethoxycarbonylpiperidin-3-yl)-piperidin-1-ylmethanesulfinate |
|---|---|
| PubChem CID | 174571620 |
| Molecular Formula | C19H27N2O4S- |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (1-phenylmethoxycarbonylpiperidin-3-yl)-piperidin-1-ylmethanesulfinate |
| SMILES | O=C(OCc1ccccc1)N1CCCC(C(N2CCCCC2)S(=O)[O-])C1 |
| InChI | InChI=1S/C19H28N2O4S/c22-19(25-15-16-8-3-1-4-9-16)21-13-7-10-17(14-21)18(26(23)24)20-11-5-2-6-12-20/h1,3-4,8-9,17-18H,2,5-7,10-15H2,(H,23,24)/p-1 |
| InChIKey | WVNGWHOTDCZZDQ-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|