C62H42N4Si2 — CID 160565485
5-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-isocyanophenyl]benzonitrile (PubChem CID 160565485) has the molecular formula C62H42N4Si2 and a molecular weight of 899.22 g/mol. Its IUPAC name is 5-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-isocyanophenyl]benzonitrile.
| Compound Name | 5-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-isocyanophenyl]benzonitrile |
|---|---|
| PubChem CID | 160565485 |
| Molecular Formula | C62H42N4Si2 |
| Molecular Weight | 899.22 g/mol |
| Exact Mass | 898.29 |
| IUPAC Name | 5-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-[4-(10,10-diphenylbenzo[b][1,4]benzazasilin-5-yl)-2-isocyanophenyl]benzonitrile |
| SMILES | [C-]#[N+]c1cc(N2c3ccccc3[Si](c3ccccc3)(c3ccccc3)c3ccccc32)ccc1-c1ccc(N2c3ccccc3[Si](c3ccccc3)(c3ccccc3)c3ccccc32)cc1C#N |
| InChI | InChI=1S/C62H42N4Si2/c1-64-54-43-47(66-57-32-16-20-36-61(57)68(50-26-10-4-11-27-50,51-28-12-5-13-29-51)62-37-21-17-33-58(62)66)39-41-53(54)52-40-38-46(42-45(52)44-63)65-55-30-14-18-34-59(55)67(48-22-6-2-7-23-48,49-24-8-3-9-25-49)60-35-19-15-31-56(60)65/h2-43H |
| InChIKey | HBSBSCMLACMUBN-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 34.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.22 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|