C63H42N7P — CID 159919783
2-[4-[2-iminophosphanyl-7-(N-phenylanilino)carbazol-9-yl]-2-isocyanophenyl]-5-[2-methyl-7-(N-phenylanilino)carbazol-9-yl]benzonitrile (PubChem CID 159919783) has the molecular formula C63H42N7P and a molecular weight of 928.05 g/mol. Its IUPAC name is 2-[4-[2-iminophosphanyl-7-(N-phenylanilino)carbazol-9-yl]-2-isocyanophenyl]-5-[2-methyl-7-(N-phenylanilino)carbazol-9-yl]benzonitrile.
| Compound Name | 2-[4-[2-iminophosphanyl-7-(N-phenylanilino)carbazol-9-yl]-2-isocyanophenyl]-5-[2-methyl-7-(N-phenylanilino)carbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 159919783 |
| Molecular Formula | C63H42N7P |
| Molecular Weight | 928.05 g/mol |
| Exact Mass | 927.32 |
| IUPAC Name | 2-[4-[2-iminophosphanyl-7-(N-phenylanilino)carbazol-9-yl]-2-isocyanophenyl]-5-[2-methyl-7-(N-phenylanilino)carbazol-9-yl]benzonitrile |
| SMILES | [H]/N=P/c1ccc2c3ccc(N(c4ccccc4)c4ccccc4)cc3n(-c3ccc(-c4ccc(-n5c6cc(C)ccc6c6ccc(N(c7ccccc7)c7ccccc7)cc65)cc4C#N)c([N+]#[C-])c3)c2c1 |
| InChI | InChI=1S/C63H42N7P/c1-42-23-29-55-56-32-26-50(67(44-15-7-3-8-16-44)45-17-9-4-10-18-45)38-61(56)69(60(55)35-42)48-24-30-53(43(36-48)41-64)54-31-25-49(37-59(54)66-2)70-62-39-51(27-33-57(62)58-34-28-52(71-65)40-63(58)70)68(46-19-11-5-12-20-46)47-21-13-6-14-22-47/h3-40,65H,1H3 |
| InChIKey | LVQVYHKNJVNZAU-UHFFFAOYSA-N |
| XLogP | 17.55 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 928.05 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|