C17H17N3O5S — CID 160579096
4-diazo-3-methoxycyclohexa-1,5-dien-1-amine;6-hydroxynaphthalene-1-sulfonic acid (PubChem CID 160579096) has the molecular formula C17H17N3O5S and a molecular weight of 375.41 g/mol. Its IUPAC name is 4-diazo-3-methoxycyclohexa-1,5-dien-1-amine;6-hydroxynaphthalene-1-sulfonic acid.
| Compound Name | 4-diazo-3-methoxycyclohexa-1,5-dien-1-amine;6-hydroxynaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 160579096 |
| Molecular Formula | C17H17N3O5S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 4-diazo-3-methoxycyclohexa-1,5-dien-1-amine;6-hydroxynaphthalene-1-sulfonic acid |
| SMILES | COC1C=C(N)C=CC1=[N+]=[N-].O=S(=O)(O)c1cccc2cc(O)ccc12 |
| InChI | InChI=1S/C10H8O4S.C7H9N3O/c11-8-4-5-9-7(6-8)2-1-3-10(9)15(12,13)14;1-11-7-4-5(8)2-3-6(7)10-9/h1-6,11H,(H,12,13,14);2-4,7H,8H2,1H3 |
| InChIKey | RBNOGVSCEAVCAE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 146.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|