C29H33N3O6 — CID 160586477
(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methanol;4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methoxy]benzonitrile (PubChem CID 160586477) has the molecular formula C29H33N3O6 and a molecular weight of 519.60 g/mol. Its IUPAC name is (2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methanol;4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methoxy]benzonitrile.
| Compound Name | (2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methanol;4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methoxy]benzonitrile |
|---|---|
| PubChem CID | 160586477 |
| Molecular Formula | C29H33N3O6 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.24 |
| IUPAC Name | (2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methanol;4-[(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)methoxy]benzonitrile |
| SMILES | Cc1ncc(CO)c2c1OC(C)(C)OC2.Cc1ncc(COc2ccc(C#N)cc2)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C18H18N2O3.C11H15NO3/c1-12-17-16(11-22-18(2,3)23-17)14(9-20-12)10-21-15-6-4-13(8-19)5-7-15;1-7-10-9(8(5-13)4-12-7)6-14-11(2,3)15-10/h4-7,9H,10-11H2,1-3H3;4,13H,5-6H2,1-3H3 |
| InChIKey | RCLOAFRHGHMLKM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 115.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |