C30H34N2O4 — CID 10323140
tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)propanoate (PubChem CID 10323140) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)propanoate.
| Compound Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)propanoate |
|---|---|
| PubChem CID | 10323140 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | tert-butyl (2S)-2-(benzhydrylideneamino)-3-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)propanoate |
| SMILES | Cc1ncc(C[C@H](N=C(c2ccccc2)c2ccccc2)C(=O)OC(C)(C)C)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C30H34N2O4/c1-20-27-24(19-34-30(5,6)35-27)23(18-31-20)17-25(28(33)36-29(2,3)4)32-26(21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,18,25H,17,19H2,1-6H3/t25-/m0/s1 |
| InChIKey | FQCUVJVQFKZOHW-VWLOTQADSA-N |
| XLogP | 5.83 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|