C12H8N2S2 — CID 160589447
5-phenylsulfanyl-2,1,3-benzothiadiazole (PubChem CID 160589447) has the molecular formula C12H8N2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 5-phenylsulfanyl-2,1,3-benzothiadiazole.
| Compound Name | 5-phenylsulfanyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 160589447 |
| Molecular Formula | C12H8N2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 5-phenylsulfanyl-2,1,3-benzothiadiazole |
| SMILES | c1ccc(Sc2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C12H8N2S2/c1-2-4-9(5-3-1)15-10-6-7-11-12(8-10)14-16-13-11/h1-8H |
| InChIKey | RCUUIVCNZCBAHX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |