C7H2N2S4 — CID 139252397
[1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole-6-thione (PubChem CID 139252397) has the molecular formula C7H2N2S4 and a molecular weight of 242.38 g/mol. Its IUPAC name is [1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole-6-thione.
| Compound Name | [1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole-6-thione |
|---|---|
| PubChem CID | 139252397 |
| Molecular Formula | C7H2N2S4 |
| Molecular Weight | 242.38 g/mol |
| Exact Mass | 241.91 |
| IUPAC Name | [1,3]dithiolo[4,5-f][2,1,3]benzothiadiazole-6-thione |
| SMILES | S=c1sc2cc3nsnc3cc2s1 |
| InChI | InChI=1S/C7H2N2S4/c10-7-11-5-1-3-4(9-13-8-3)2-6(5)12-7/h1-2H |
| InChIKey | HSNHINFLSMBQFD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|