C16H34 — CID 160593852
methane;2,5,5-trimethyl-3,7-dimethylidenenonane (PubChem CID 160593852) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is methane;2,5,5-trimethyl-3,7-dimethylidenenonane.
| Compound Name | methane;2,5,5-trimethyl-3,7-dimethylidenenonane |
|---|---|
| PubChem CID | 160593852 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | methane;2,5,5-trimethyl-3,7-dimethylidenenonane |
| SMILES | C.C.C=C(CC)CC(C)(C)CC(=C)C(C)C |
| InChI | InChI=1S/C14H26.2CH4/c1-8-12(4)9-14(6,7)10-13(5)11(2)3;;/h11H,4-5,8-10H2,1-3,6-7H3;2*1H4 |
| InChIKey | RDJIRVNRNJRNAC-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|